C23H29FN2O2 — CID 22038243
1-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]oxy]ethanol (PubChem CID 22038243) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]oxy]ethanol.
| Compound Name | 1-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]oxy]ethanol |
|---|---|
| PubChem CID | 22038243 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]oxy]ethanol |
| SMILES | CC(O)Oc1ccc2c(c1)N(C1CCN(CCc3ccc(F)cc3)CC1)CC2 |
| InChI | InChI=1S/C23H29FN2O2/c1-17(27)28-22-7-4-19-9-15-26(23(19)16-22)21-10-13-25(14-11-21)12-8-18-2-5-20(24)6-3-18/h2-7,16-17,21,27H,8-15H2,1H3 |
| InChIKey | FFJLKLUAGRZIOL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|