C23H30FN3O2S — CID 23377505
N-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]methylsulfanylperoxy]methanamine (PubChem CID 23377505) has the molecular formula C23H30FN3O2S and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]methylsulfanylperoxy]methanamine.
| Compound Name | N-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]methylsulfanylperoxy]methanamine |
|---|---|
| PubChem CID | 23377505 |
| Molecular Formula | C23H30FN3O2S |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-2,3-dihydroindol-6-yl]methylsulfanylperoxy]methanamine |
| SMILES | CNOOSCc1ccc2c(c1)N(C1CCN(CCc3ccc(F)cc3)CC1)CC2 |
| InChI | InChI=1S/C23H30FN3O2S/c1-25-28-29-30-17-19-2-5-20-9-15-27(23(20)16-19)22-10-13-26(14-11-22)12-8-18-3-6-21(24)7-4-18/h2-7,16,22,25H,8-15,17H2,1H3 |
| InChIKey | NQWXPWBXLMJPNM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|