About ethane;2-methoxy-2-methylpropane;3-phenoxypropanal
ethane;2-methoxy-2-methylpropane;3-phenoxypropanal (PubChem CID 143934992) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is ethane;2-methoxy-2-methylpropane;3-phenoxypropanal.
Molecular Properties
| Compound Name | ethane;2-methoxy-2-methylpropane;3-phenoxypropanal |
| PubChem CID | 143934992 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | ethane;2-methoxy-2-methylpropane;3-phenoxypropanal |
| SMILES | CC.COC(C)(C)C.O=CCCOc1ccccc1 |
| InChI | InChI=1S/C9H10O2.C5H12O.C2H6/c10-7-4-8-11-9-5-2-1-3-6-9;1-5(2,3)6-4;1-2/h1-3,5-7H,4,8H2;1-4H3;1-2H3 |
| InChIKey | JHBHXWRPXZDVLQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methoxy-2-methylpropane;3-phenoxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-2-methylpropane;3-phenoxypropanal?
The IUPAC name of ethane;2-methoxy-2-methylpropane;3-phenoxypropanal (CID 143934992) is ethane;2-methoxy-2-methylpropane;3-phenoxypropanal.
What is the SMILES notation for ethane;2-methoxy-2-methylpropane;3-phenoxypropanal?
The canonical SMILES for ethane;2-methoxy-2-methylpropane;3-phenoxypropanal is CC.COC(C)(C)C.O=CCCOc1ccccc1.
What is the InChIKey of ethane;2-methoxy-2-methylpropane;3-phenoxypropanal?
The InChIKey is JHBHXWRPXZDVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C5H12O.C2H6/c10-7-4-8-11-9-5-2-1-3-6-9;1-5(2,3)6-4;1-2/h1-3,5-7H,4,8H2;1-4H3;1-2H3.
What are the key properties of ethane;2-methoxy-2-methylpropane;3-phenoxypropanal?
ethane;2-methoxy-2-methylpropane;3-phenoxypropanal has a molecular weight of 268.40 g/mol, XLogP of 4.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-2-methylpropane;3-phenoxypropanal is sourced from PubChem (CID 143934992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).