About methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide
methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide (PubChem CID 143936298) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide.
Molecular Properties
| Compound Name | methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide |
| PubChem CID | 143936298 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide |
| SMILES | C.CC(C)C1CC(NC=O)CN1C |
| InChI | InChI=1S/C9H18N2O.CH4/c1-7(2)9-4-8(10-6-12)5-11(9)3;/h6-9H,4-5H2,1-3H3,(H,10,12);1H4 |
| InChIKey | GHAZCRJIFWNJHR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide?
The IUPAC name of methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide (CID 143936298) is methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide.
What is the SMILES notation for methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide?
The canonical SMILES for methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide is C.CC(C)C1CC(NC=O)CN1C.
What is the InChIKey of methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide?
The InChIKey is GHAZCRJIFWNJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.CH4/c1-7(2)9-4-8(10-6-12)5-11(9)3;/h6-9H,4-5H2,1-3H3,(H,10,12);1H4.
What are the key properties of methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide?
methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide has a molecular weight of 186.30 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-(1-methyl-5-propan-2-ylpyrrolidin-3-yl)formamide is sourced from PubChem (CID 143936298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).