C32H40Cl2FN5O4 — CID 143936509
chloroethane;4-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-1-(oxan-4-yl)piperazin-2-one (PubChem CID 143936509) has the molecular formula C32H40Cl2FN5O4 and a molecular weight of 648.61 g/mol. Its IUPAC name is chloroethane;4-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-1-(oxan-4-yl)piperazin-2-one.
| Compound Name | chloroethane;4-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-1-(oxan-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 143936509 |
| Molecular Formula | C32H40Cl2FN5O4 |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | chloroethane;4-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-1-(oxan-4-yl)piperazin-2-one |
| SMILES | CCCl.COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1OC1CCC(N2CCN(C3CCOCC3)C(=O)C2)CC1 |
| InChI | InChI=1S/C30H35ClFN5O4.C2H5Cl/c1-39-26-16-25-22(30(34-18-33-25)35-24-4-2-3-23(31)29(24)32)15-27(26)41-21-7-5-19(6-8-21)36-11-12-37(28(38)17-36)20-9-13-40-14-10-20;1-2-3/h2-4,15-16,18-21H,5-14,17H2,1H3,(H,33,34,35);2H2,1H3 |
| InChIKey | ATDWNFVTWPABKM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|