C19H26FN3 — CID 143937099
5-(4-fluorophenyl)-N-[(4-propylcyclohexyl)methyl]-1H-pyrazol-3-amine (PubChem CID 143937099) has the molecular formula C19H26FN3 and a molecular weight of 315.44 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[(4-propylcyclohexyl)methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-(4-fluorophenyl)-N-[(4-propylcyclohexyl)methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 143937099 |
| Molecular Formula | C19H26FN3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[(4-propylcyclohexyl)methyl]-1H-pyrazol-3-amine |
| SMILES | CCCC1CCC(CNc2cc(-c3ccc(F)cc3)[nH]n2)CC1 |
| InChI | InChI=1S/C19H26FN3/c1-2-3-14-4-6-15(7-5-14)13-21-19-12-18(22-23-19)16-8-10-17(20)11-9-16/h8-12,14-15H,2-7,13H2,1H3,(H2,21,22,23) |
| InChIKey | MVMCIQILBFDIHE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |