C14H20N2O2 — CID 143937168
ethyl (E)-3-amino-2-(3,5-dimethylphenoxy)but-2-enimidate (PubChem CID 143937168) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-(3,5-dimethylphenoxy)but-2-enimidate.
| Compound Name | ethyl (E)-3-amino-2-(3,5-dimethylphenoxy)but-2-enimidate |
|---|---|
| PubChem CID | 143937168 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | ethyl (E)-3-amino-2-(3,5-dimethylphenoxy)but-2-enimidate |
| SMILES | [H]/N=C(OCC)/C(Oc1cc(C)cc(C)c1)=C(/C)N |
| InChI | InChI=1S/C14H20N2O2/c1-5-17-14(16)13(11(4)15)18-12-7-9(2)6-10(3)8-12/h6-8,16H,5,15H2,1-4H3/b13-11+,16-14- |
| InChIKey | ZKVHGRJOUJJUCG-HZMBCIISSA-N |
| XLogP | 2.89 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|