C7H12N2S — CID 143938998
[(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene (PubChem CID 143938998) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene.
| Compound Name | [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene |
|---|---|
| PubChem CID | 143938998 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene |
| SMILES | [H]/N=N/C(=C\C=C\SC)CC |
| InChI | InChI=1S/C7H12N2S/c1-3-7(9-8)5-4-6-10-2/h4-6,8H,3H2,1-2H3/b6-4+,7-5-,9-8+ |
| InChIKey | MRJCSSZXOAOIII-PQWITGTASA-N |
| XLogP | 3.19 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|