About [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene
[(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene (PubChem CID 143938998) has the molecular formula C7H12N2S
and a molecular weight of 156.25 g/mol. Its IUPAC name is [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene.
Molecular Properties
| Compound Name | [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene |
| PubChem CID | 143938998 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene |
| SMILES | [H]/N=N/C(=C\C=C\SC)CC |
| InChI | InChI=1S/C7H12N2S/c1-3-7(9-8)5-4-6-10-2/h4-6,8H,3H2,1-2H3/b6-4+,7-5-,9-8+ |
| InChIKey | MRJCSSZXOAOIII-PQWITGTASA-N |
| XLogP | 3.19 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene?
The IUPAC name of [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene (CID 143938998) is [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene.
What is the SMILES notation for [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene?
The canonical SMILES for [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene is [H]/N=N/C(=C\C=C\SC)CC.
What is the InChIKey of [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene?
The InChIKey is MRJCSSZXOAOIII-PQWITGTASA-N. The full InChI is InChI=1S/C7H12N2S/c1-3-7(9-8)5-4-6-10-2/h4-6,8H,3H2,1-2H3/b6-4+,7-5-,9-8+.
What are the key properties of [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene?
[(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene has a molecular weight of 156.25 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5E)-6-methylsulfanylhexa-3,5-dien-3-yl]diazene is sourced from PubChem (CID 143938998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).