C13H21N3O2 — CID 143940516
ethane;2-methyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyrimidin-6-one (PubChem CID 143940516) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethane;2-methyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyrimidin-6-one.
| Compound Name | ethane;2-methyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143940516 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | ethane;2-methyl-5-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyrimidin-6-one |
| SMILES | CC.Cc1ncc(CC(=O)N2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N3O2.C2H6/c1-8-12-7-9(11(16)13-8)6-10(15)14-4-2-3-5-14;1-2/h7H,2-6H2,1H3,(H,12,13,16);1-2H3 |
| InChIKey | ZBFYYMKDNAOWQG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |