C21H17F2N3O3 — CID 143941862
1-[[4-[(2Z)-2-[(Z)-but-2-enylidene]hydrazinyl]phenyl]methyl]-5,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 143941862) has the molecular formula C21H17F2N3O3 and a molecular weight of 397.38 g/mol. Its IUPAC name is 1-[[4-[(2Z)-2-[(Z)-but-2-enylidene]hydrazinyl]phenyl]methyl]-5,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[[4-[(2Z)-2-[(Z)-but-2-enylidene]hydrazinyl]phenyl]methyl]-5,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143941862 |
| Molecular Formula | C21H17F2N3O3 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-[[4-[(2Z)-2-[(Z)-but-2-enylidene]hydrazinyl]phenyl]methyl]-5,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | C/C=C\C=N/Nc1ccc(Cn2cc(C(=O)O)c(=O)c3c(F)ccc(F)c32)cc1 |
| InChI | InChI=1S/C21H17F2N3O3/c1-2-3-10-24-25-14-6-4-13(5-7-14)11-26-12-15(21(28)29)20(27)18-16(22)8-9-17(23)19(18)26/h2-10,12,25H,11H2,1H3,(H,28,29)/b3-2-,24-10- |
| InChIKey | QTWNIWCXPRZXFZ-NAIXGYIJSA-N |
| XLogP | 4.00 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|