C23H21F2NO4 — CID 155106719
5,8-difluoro-3-[(E)-6-hydroxyhex-2-enoyl]-1-[(4-methoxyphenyl)methyl]quinolin-4-one (PubChem CID 155106719) has the molecular formula C23H21F2NO4 and a molecular weight of 413.42 g/mol. Its IUPAC name is 5,8-difluoro-3-[(E)-6-hydroxyhex-2-enoyl]-1-[(4-methoxyphenyl)methyl]quinolin-4-one.
| Compound Name | 5,8-difluoro-3-[(E)-6-hydroxyhex-2-enoyl]-1-[(4-methoxyphenyl)methyl]quinolin-4-one |
|---|---|
| PubChem CID | 155106719 |
| Molecular Formula | C23H21F2NO4 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 5,8-difluoro-3-[(E)-6-hydroxyhex-2-enoyl]-1-[(4-methoxyphenyl)methyl]quinolin-4-one |
| SMILES | COc1ccc(Cn2cc(C(=O)/C=C/CCCO)c(=O)c3c(F)ccc(F)c32)cc1 |
| InChI | InChI=1S/C23H21F2NO4/c1-30-16-8-6-15(7-9-16)13-26-14-17(20(28)5-3-2-4-12-27)23(29)21-18(24)10-11-19(25)22(21)26/h3,5-11,14,27H,2,4,12-13H2,1H3/b5-3+ |
| InChIKey | FZWAVOGWKQMHKR-HWKANZROSA-N |
| XLogP | 3.85 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|