C24H24N4O4 — CID 143942744
4-[2-(2-carboxyethyl)-5-[4-(N'-methyl-N-methyliminocarbamimidoyl)phenyl]pyrrol-1-yl]-3-methylbenzoic acid (PubChem CID 143942744) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-5-[4-(N'-methyl-N-methyliminocarbamimidoyl)phenyl]pyrrol-1-yl]-3-methylbenzoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-5-[4-(N'-methyl-N-methyliminocarbamimidoyl)phenyl]pyrrol-1-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 143942744 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-5-[4-(N'-methyl-N-methyliminocarbamimidoyl)phenyl]pyrrol-1-yl]-3-methylbenzoic acid |
| SMILES | C/N=C(\N=N\C)c1ccc(-c2ccc(CCC(=O)O)n2-c2ccc(C(=O)O)cc2C)cc1 |
| InChI | InChI=1S/C24H24N4O4/c1-15-14-18(24(31)32)8-11-20(15)28-19(10-13-22(29)30)9-12-21(28)16-4-6-17(7-5-16)23(25-2)27-26-3/h4-9,11-12,14H,10,13H2,1-3H3,(H,29,30)(H,31,32)/b25-23-,27-26+ |
| InChIKey | VUNSKGHGEYKJHF-TZDKTLMISA-N |
| XLogP | 4.63 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|