C16H22N4O2 — CID 143943199
6-amino-N-phenylpyrimidine-4-carboxamide;3-methylbutan-1-ol (PubChem CID 143943199) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 6-amino-N-phenylpyrimidine-4-carboxamide;3-methylbutan-1-ol.
| Compound Name | 6-amino-N-phenylpyrimidine-4-carboxamide;3-methylbutan-1-ol |
|---|---|
| PubChem CID | 143943199 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 6-amino-N-phenylpyrimidine-4-carboxamide;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.Nc1cc(C(=O)Nc2ccccc2)ncn1 |
| InChI | InChI=1S/C11H10N4O.C5H12O/c12-10-6-9(13-7-14-10)11(16)15-8-4-2-1-3-5-8;1-5(2)3-4-6/h1-7H,(H,15,16)(H2,12,13,14);5-6H,3-4H2,1-2H3 |
| InChIKey | KHXQROWGWHWGJN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |