C11H18N2 — CID 143947974
N-methyl-N-(1-pyridin-3-ylethyl)propan-1-amine (PubChem CID 143947974) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-methyl-N-(1-pyridin-3-ylethyl)propan-1-amine.
| Compound Name | N-methyl-N-(1-pyridin-3-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 143947974 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-methyl-N-(1-pyridin-3-ylethyl)propan-1-amine |
| SMILES | CCCN(C)C(C)c1cccnc1 |
| InChI | InChI=1S/C11H18N2/c1-4-8-13(3)10(2)11-6-5-7-12-9-11/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | DUFPKGNJOFYNLM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |