C13H22N2 — CID 130465955
(1R,2R)-N,N,2,3-tetramethyl-1-pyridin-3-ylbutan-1-amine (PubChem CID 130465955) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (1R,2R)-N,N,2,3-tetramethyl-1-pyridin-3-ylbutan-1-amine.
| Compound Name | (1R,2R)-N,N,2,3-tetramethyl-1-pyridin-3-ylbutan-1-amine |
|---|---|
| PubChem CID | 130465955 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (1R,2R)-N,N,2,3-tetramethyl-1-pyridin-3-ylbutan-1-amine |
| SMILES | CC(C)[C@@H](C)[C@H](c1cccnc1)N(C)C |
| InChI | InChI=1S/C13H22N2/c1-10(2)11(3)13(15(4)5)12-7-6-8-14-9-12/h6-11,13H,1-5H3/t11-,13-/m1/s1 |
| InChIKey | XUPIHVNWDUKMCU-DGCLKSJQSA-N |
| XLogP | 2.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |