C22H30FN5O2S — CID 143948173
ethane;N-(4-fluoro-2-piperidin-4-yloxyphenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine;formamide (PubChem CID 143948173) has the molecular formula C22H30FN5O2S and a molecular weight of 447.58 g/mol. Its IUPAC name is ethane;N-(4-fluoro-2-piperidin-4-yloxyphenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine;formamide.
| Compound Name | ethane;N-(4-fluoro-2-piperidin-4-yloxyphenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine;formamide |
|---|---|
| PubChem CID | 143948173 |
| Molecular Formula | C22H30FN5O2S |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | ethane;N-(4-fluoro-2-piperidin-4-yloxyphenyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine;formamide |
| SMILES | CC.Cc1sc2ncnc(Nc3ccc(F)cc3OC3CCNCC3)c2c1C.NC=O |
| InChI | InChI=1S/C19H21FN4OS.C2H6.CH3NO/c1-11-12(2)26-19-17(11)18(22-10-23-19)24-15-4-3-13(20)9-16(15)25-14-5-7-21-8-6-14;1-2;2-1-3/h3-4,9-10,14,21H,5-8H2,1-2H3,(H,22,23,24);1-2H3;1H,(H2,2,3) |
| InChIKey | YEMGXBVKIOZMRR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|