C20H18FN3O2S — CID 89090882
6-ethynyl-N-[4-fluoro-2-(oxan-4-yloxy)phenyl]-5-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 89090882) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is 6-ethynyl-N-[4-fluoro-2-(oxan-4-yloxy)phenyl]-5-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethynyl-N-[4-fluoro-2-(oxan-4-yloxy)phenyl]-5-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 89090882 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-ethynyl-N-[4-fluoro-2-(oxan-4-yloxy)phenyl]-5-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C#Cc1sc2ncnc(Nc3ccc(F)cc3OC3CCOCC3)c2c1C |
| InChI | InChI=1S/C20H18FN3O2S/c1-3-17-12(2)18-19(22-11-23-20(18)27-17)24-15-5-4-13(21)10-16(15)26-14-6-8-25-9-7-14/h1,4-5,10-11,14H,6-9H2,2H3,(H,22,23,24) |
| InChIKey | APWRIJRZFBMPRV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|