C23H28FN5O3S — CID 53373805
N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-[(3S)-oxolan-3-yl]oxyanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 53373805) has the molecular formula C23H28FN5O3S and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-[(3S)-oxolan-3-yl]oxyanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-[(3S)-oxolan-3-yl]oxyanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 53373805 |
| Molecular Formula | C23H28FN5O3S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[4-fluoro-2-[(3S)-oxolan-3-yl]oxyanilino]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN(C)C)sc2ncnc(Nc3ccc(F)cc3O[C@H]3CCOC3)c12 |
| InChI | InChI=1S/C23H28FN5O3S/c1-14-19-21(28-17-6-5-15(24)11-18(17)32-16-7-10-31-12-16)26-13-27-23(19)33-20(14)22(30)25-8-4-9-29(2)3/h5-6,11,13,16H,4,7-10,12H2,1-3H3,(H,25,30)(H,26,27,28)/t16-/m0/s1 |
| InChIKey | LRHDUHZSPAJSHL-INIZCTEOSA-N |
| XLogP | 3.73 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|