C27H33F4N5O6S — CID 162314721
4-[2-[(3R,5S)-3,5-dihydroxycyclohexyl]oxy-4-fluoroanilino]-N-[3-(dimethylamino)propyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 162314721) has the molecular formula C27H33F4N5O6S and a molecular weight of 631.65 g/mol. Its IUPAC name is 4-[2-[(3R,5S)-3,5-dihydroxycyclohexyl]oxy-4-fluoroanilino]-N-[3-(dimethylamino)propyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[(3R,5S)-3,5-dihydroxycyclohexyl]oxy-4-fluoroanilino]-N-[3-(dimethylamino)propyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162314721 |
| Molecular Formula | C27H33F4N5O6S |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | 4-[2-[(3R,5S)-3,5-dihydroxycyclohexyl]oxy-4-fluoroanilino]-N-[3-(dimethylamino)propyl]-5-methylthieno[2,3-d]pyrimidine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(C(=O)NCCCN(C)C)sc2ncnc(Nc3ccc(F)cc3OC3C[C@@H](O)C[C@@H](O)C3)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H32FN5O4S.C2HF3O2/c1-14-21-23(28-13-29-25(21)36-22(14)24(34)27-7-4-8-31(2)3)30-19-6-5-15(26)9-20(19)35-18-11-16(32)10-17(33)12-18;3-2(4,5)1(6)7/h5-6,9,13,16-18,32-33H,4,7-8,10-12H2,1-3H3,(H,27,34)(H,28,29,30);(H,6,7)/t16-,17+,18?; |
| InChIKey | YQGCBLLGHSDRBA-IESHXZMMSA-N |
| XLogP | 3.85 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|