About 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate
4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate (PubChem CID 143948784) has the molecular formula C23H30O4
and a molecular weight of 370.49 g/mol. Its IUPAC name is 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate.
Molecular Properties
| Compound Name | 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate |
| PubChem CID | 143948784 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate |
| SMILES | CC(O)CC(=O)OCCCCOc1ccc(-c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H30O4/c1-17(2)19-6-8-20(9-7-19)21-10-12-22(13-11-21)26-14-4-5-15-27-23(25)16-18(3)24/h6-13,17-18,24H,4-5,14-16H2,1-3H3 |
| InChIKey | CGHJOLPIKBPBRH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate?
The IUPAC name of 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate (CID 143948784) is 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate.
What is the SMILES notation for 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate?
The canonical SMILES for 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate is CC(O)CC(=O)OCCCCOc1ccc(-c2ccc(C(C)C)cc2)cc1.
What is the InChIKey of 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate?
The InChIKey is CGHJOLPIKBPBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O4/c1-17(2)19-6-8-20(9-7-19)21-10-12-22(13-11-21)26-14-4-5-15-27-23(25)16-18(3)24/h6-13,17-18,24H,4-5,14-16H2,1-3H3.
What are the key properties of 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate?
4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate has a molecular weight of 370.49 g/mol, XLogP of 4.95, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-propan-2-ylphenyl)phenoxy]butyl 3-hydroxybutanoate is sourced from PubChem (CID 143948784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).