C24H30BrNO2 — CID 143950608
(1S)-3-[(1R,2R)-1-(4-bromo-3-methoxyphenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cycloheptan-1-amine (PubChem CID 143950608) has the molecular formula C24H30BrNO2 and a molecular weight of 444.41 g/mol. Its IUPAC name is (1S)-3-[(1R,2R)-1-(4-bromo-3-methoxyphenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cycloheptan-1-amine.
| Compound Name | (1S)-3-[(1R,2R)-1-(4-bromo-3-methoxyphenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cycloheptan-1-amine |
|---|---|
| PubChem CID | 143950608 |
| Molecular Formula | C24H30BrNO2 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (1S)-3-[(1R,2R)-1-(4-bromo-3-methoxyphenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cycloheptan-1-amine |
| SMILES | COc1cc(O[C@H]2c3ccccc3CC[C@@H]2C2CCCC[C@H](N)C2)ccc1Br |
| InChI | InChI=1S/C24H30BrNO2/c1-27-23-15-19(11-13-22(23)25)28-24-20-9-5-3-6-16(20)10-12-21(24)17-7-2-4-8-18(26)14-17/h3,5-6,9,11,13,15,17-18,21,24H,2,4,7-8,10,12,14,26H2,1H3/t17?,18-,21+,24-/m0/s1 |
| InChIKey | BBMQKHNTKVKLAO-KVAJZNIESA-N |
| XLogP | 6.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |