C29H36F3N7O2S — CID 143953384
4-[2-(6,7-dimethoxy-1-propyl-3,4-dihydro-1H-isoquinolin-2-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine (PubChem CID 143953384) has the molecular formula C29H36F3N7O2S and a molecular weight of 603.72 g/mol. Its IUPAC name is 4-[2-(6,7-dimethoxy-1-propyl-3,4-dihydro-1H-isoquinolin-2-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine.
| Compound Name | 4-[2-(6,7-dimethoxy-1-propyl-3,4-dihydro-1H-isoquinolin-2-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
|---|---|
| PubChem CID | 143953384 |
| Molecular Formula | C29H36F3N7O2S |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | 4-[2-(6,7-dimethoxy-1-propyl-3,4-dihydro-1H-isoquinolin-2-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
| SMILES | [H]/N=C1\CN(c2nc(N3CCc4cc(OC)c(OC)cc4C3CCC)nc3sc(CCC)cc23)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C29H36F3N7O2S/c1-5-7-18-14-20-25(37-11-12-39(24(33)16-37)27(34)29(30,31)32)35-28(36-26(20)42-18)38-10-9-17-13-22(40-3)23(41-4)15-19(17)21(38)8-6-2/h13-15,21,33-34H,5-12,16H2,1-4H3/b33-24+,34-27+ |
| InChIKey | MJHIBFYLBSVURP-LZSAFNKESA-N |
| XLogP | 6.20 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|