C18H26N6O2S — CID 143953498
3-[4-(4-ethanimidoyl-3-iminopiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-2-yl]oxypropan-1-ol (PubChem CID 143953498) has the molecular formula C18H26N6O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-[4-(4-ethanimidoyl-3-iminopiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-2-yl]oxypropan-1-ol.
| Compound Name | 3-[4-(4-ethanimidoyl-3-iminopiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-2-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 143953498 |
| Molecular Formula | C18H26N6O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-[4-(4-ethanimidoyl-3-iminopiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-2-yl]oxypropan-1-ol |
| SMILES | [H]/N=C(\C)N1CCN(c2nc(OCCCO)nc3sc(CCC)cc23)C/C1=N\[H] |
| InChI | InChI=1S/C18H26N6O2S/c1-3-5-13-10-14-16(23-6-7-24(12(2)19)15(20)11-23)21-18(22-17(14)27-13)26-9-4-8-25/h10,19-20,25H,3-9,11H2,1-2H3/b19-12+,20-15+ |
| InChIKey | RYXNVRNNBVPTAW-IRVPIMSSSA-N |
| XLogP | 2.50 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|