C18H25F2N7O2S — CID 143953458
2-[4-[4-(3-amino-2,2-difluoropropanimidoyl)-3-iminopiperazin-1-yl]-6-propylthieno[2,3-d]pyrimidin-2-yl]oxyethanol (PubChem CID 143953458) has the molecular formula C18H25F2N7O2S and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-[4-[4-(3-amino-2,2-difluoropropanimidoyl)-3-iminopiperazin-1-yl]-6-propylthieno[2,3-d]pyrimidin-2-yl]oxyethanol.
| Compound Name | 2-[4-[4-(3-amino-2,2-difluoropropanimidoyl)-3-iminopiperazin-1-yl]-6-propylthieno[2,3-d]pyrimidin-2-yl]oxyethanol |
|---|---|
| PubChem CID | 143953458 |
| Molecular Formula | C18H25F2N7O2S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[4-[4-(3-amino-2,2-difluoropropanimidoyl)-3-iminopiperazin-1-yl]-6-propylthieno[2,3-d]pyrimidin-2-yl]oxyethanol |
| SMILES | [H]/N=C1\CN(c2nc(OCCO)nc3sc(CCC)cc23)CCN1/C(=N/[H])C(F)(F)CN |
| InChI | InChI=1S/C18H25F2N7O2S/c1-2-3-11-8-12-14(24-17(29-7-6-28)25-15(12)30-11)26-4-5-27(13(22)9-26)16(23)18(19,20)10-21/h8,22-23,28H,2-7,9-10,21H2,1H3/b22-13+,23-16+ |
| InChIKey | BZOBYZKRFLJPIF-WRXOINPPSA-N |
| XLogP | 1.69 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|