C9H12N2 — CID 143954269
(4E,5E)-5-but-3-enylidene-4-ethylidene-1H-imidazole (PubChem CID 143954269) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (4E,5E)-5-but-3-enylidene-4-ethylidene-1H-imidazole.
| Compound Name | (4E,5E)-5-but-3-enylidene-4-ethylidene-1H-imidazole |
|---|---|
| PubChem CID | 143954269 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (4E,5E)-5-but-3-enylidene-4-ethylidene-1H-imidazole |
| SMILES | C=CC/C=c1/[nH]cn/c1=C/C |
| InChI | InChI=1S/C9H12N2/c1-3-5-6-9-8(4-2)10-7-11-9/h3-4,6-7H,1,5H2,2H3,(H,10,11)/b8-4+,9-6+ |
| InChIKey | AAHRFFOFDOFVRK-HNJDCKIISA-N |
| XLogP | 0.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|