C20H39NO3S — CID 143954777
(5E,7Z)-1-amino-6-(cycloheptylmethylsulfanyl)deca-5,7-diene-1,1,3-triol;ethane (PubChem CID 143954777) has the molecular formula C20H39NO3S and a molecular weight of 373.60 g/mol. Its IUPAC name is (5E,7Z)-1-amino-6-(cycloheptylmethylsulfanyl)deca-5,7-diene-1,1,3-triol;ethane.
| Compound Name | (5E,7Z)-1-amino-6-(cycloheptylmethylsulfanyl)deca-5,7-diene-1,1,3-triol;ethane |
|---|---|
| PubChem CID | 143954777 |
| Molecular Formula | C20H39NO3S |
| Molecular Weight | 373.60 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | (5E,7Z)-1-amino-6-(cycloheptylmethylsulfanyl)deca-5,7-diene-1,1,3-triol;ethane |
| SMILES | CC.CC/C=C\C(=C/CC(O)CC(N)(O)O)SCC1CCCCCC1 |
| InChI | InChI=1S/C18H33NO3S.C2H6/c1-2-3-10-17(12-11-16(20)13-18(19,21)22)23-14-15-8-6-4-5-7-9-15;1-2/h3,10,12,15-16,20-22H,2,4-9,11,13-14,19H2,1H3;1-2H3/b10-3-,17-12+; |
| InChIKey | WTEZKMVHCYBYDM-NVONCUJRSA-N |
| XLogP | 4.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|