C16H29NO4S — CID 143954873
(5E,7Z)-1-amino-6-(cyclohexylmethylsulfinyl)nona-5,7-diene-1,1,3-triol (PubChem CID 143954873) has the molecular formula C16H29NO4S and a molecular weight of 331.48 g/mol. Its IUPAC name is (5E,7Z)-1-amino-6-(cyclohexylmethylsulfinyl)nona-5,7-diene-1,1,3-triol.
| Compound Name | (5E,7Z)-1-amino-6-(cyclohexylmethylsulfinyl)nona-5,7-diene-1,1,3-triol |
|---|---|
| PubChem CID | 143954873 |
| Molecular Formula | C16H29NO4S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (5E,7Z)-1-amino-6-(cyclohexylmethylsulfinyl)nona-5,7-diene-1,1,3-triol |
| SMILES | C/C=C\C(=C/CC(O)CC(N)(O)O)S(=O)CC1CCCCC1 |
| InChI | InChI=1S/C16H29NO4S/c1-2-6-15(10-9-14(18)11-16(17,19)20)22(21)12-13-7-4-3-5-8-13/h2,6,10,13-14,18-20H,3-5,7-9,11-12,17H2,1H3/b6-2-,15-10+ |
| InChIKey | WFFDUAHHVLAQGQ-QNIDQRENSA-N |
| XLogP | 1.51 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|