C22H12N2O8 — CID 143956163
2-[4-(6,7-dihydroxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-6,7-dihydroxy-3,1-benzoxazin-4-one (PubChem CID 143956163) has the molecular formula C22H12N2O8 and a molecular weight of 432.34 g/mol. Its IUPAC name is 2-[4-(6,7-dihydroxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-6,7-dihydroxy-3,1-benzoxazin-4-one.
| Compound Name | 2-[4-(6,7-dihydroxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-6,7-dihydroxy-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 143956163 |
| Molecular Formula | C22H12N2O8 |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-[4-(6,7-dihydroxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-6,7-dihydroxy-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2ccc(-c3nc4cc(O)c(O)cc4c(=O)o3)cc2)nc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C22H12N2O8/c25-15-5-11-13(7-17(15)27)23-19(31-21(11)29)9-1-2-10(4-3-9)20-24-14-8-18(28)16(26)6-12(14)22(30)32-20/h1-8,25-28H |
| InChIKey | QVCCTPYRHCBGSR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 167.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|