C16H22N2O4 — CID 14395710
(3aR,4S,6S,7R,7aR)-4,7-dihydroxy-3-methyl-6-[[(1R)-1-phenylethyl]amino]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 14395710) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3aR,4S,6S,7R,7aR)-4,7-dihydroxy-3-methyl-6-[[(1R)-1-phenylethyl]amino]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aR,4S,6S,7R,7aR)-4,7-dihydroxy-3-methyl-6-[[(1R)-1-phenylethyl]amino]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 14395710 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3aR,4S,6S,7R,7aR)-4,7-dihydroxy-3-methyl-6-[[(1R)-1-phenylethyl]amino]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | C[C@@H](N[C@H]1C[C@H](O)[C@@H]2[C@@H](OC(=O)N2C)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-9(10-6-4-3-5-7-10)17-11-8-12(19)13-15(14(11)20)22-16(21)18(13)2/h3-7,9,11-15,17,19-20H,8H2,1-2H3/t9-,11+,12+,13-,14-,15-/m1/s1 |
| InChIKey | FJNPCPXJICHTII-UDYJRIAMSA-N |
| XLogP | 0.65 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |