C17H26ClN5 — CID 143957577
(Z)-N-(4-chloro-2-methylphenyl)-2-hydrazinyl-3-methyl-1-piperazin-1-ylpent-2-en-1-imine (PubChem CID 143957577) has the molecular formula C17H26ClN5 and a molecular weight of 335.88 g/mol. Its IUPAC name is (Z)-N-(4-chloro-2-methylphenyl)-2-hydrazinyl-3-methyl-1-piperazin-1-ylpent-2-en-1-imine.
| Compound Name | (Z)-N-(4-chloro-2-methylphenyl)-2-hydrazinyl-3-methyl-1-piperazin-1-ylpent-2-en-1-imine |
|---|---|
| PubChem CID | 143957577 |
| Molecular Formula | C17H26ClN5 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (Z)-N-(4-chloro-2-methylphenyl)-2-hydrazinyl-3-methyl-1-piperazin-1-ylpent-2-en-1-imine |
| SMILES | CC/C(C)=C(NN)/C(=N/c1ccc(Cl)cc1C)N1CCNCC1 |
| InChI | InChI=1S/C17H26ClN5/c1-4-12(2)16(22-19)17(23-9-7-20-8-10-23)21-15-6-5-14(18)11-13(15)3/h5-6,11,20,22H,4,7-10,19H2,1-3H3/b16-12-,21-17- |
| InChIKey | RQOMUOXZLRVCLS-YXRRRITLSA-N |
| XLogP | 2.73 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|