C25H27N3O4 — CID 143958012
[(9R)-2-(2-hydroxy-2-methylpropoxy)-1-methyl-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate (PubChem CID 143958012) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is [(9R)-2-(2-hydroxy-2-methylpropoxy)-1-methyl-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate.
| Compound Name | [(9R)-2-(2-hydroxy-2-methylpropoxy)-1-methyl-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate |
|---|---|
| PubChem CID | 143958012 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [(9R)-2-(2-hydroxy-2-methylpropoxy)-1-methyl-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate |
| SMILES | [H]/N=C(\N)OC[C@@H]1c2cc(-c3cccnc3)ccc2Oc2ccc(OCC(C)(C)O)c(C)c21 |
| InChI | InChI=1S/C25H27N3O4/c1-15-20(31-14-25(2,3)29)8-9-22-23(15)19(13-30-24(26)27)18-11-16(6-7-21(18)32-22)17-5-4-10-28-12-17/h4-12,19,29H,13-14H2,1-3H3,(H3,26,27)/t19-/m1/s1 |
| InChIKey | AUWSFEDGRWHZHA-LJQANCHMSA-N |
| XLogP | 4.35 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|