C25H24N4O3 — CID 143958016
[(9R)-2-(2-cyano-2-methylpropoxy)-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate (PubChem CID 143958016) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is [(9R)-2-(2-cyano-2-methylpropoxy)-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate.
| Compound Name | [(9R)-2-(2-cyano-2-methylpropoxy)-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate |
|---|---|
| PubChem CID | 143958016 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [(9R)-2-(2-cyano-2-methylpropoxy)-7-pyridin-3-yl-9H-xanthen-9-yl]methyl carbamimidate |
| SMILES | [H]/N=C(\N)OC[C@H]1c2cc(OCC(C)(C)C#N)ccc2Oc2ccc(-c3cccnc3)cc21 |
| InChI | InChI=1S/C25H24N4O3/c1-25(2,14-26)15-31-18-6-8-23-20(11-18)21(13-30-24(27)28)19-10-16(5-7-22(19)32-23)17-4-3-9-29-12-17/h3-12,21H,13,15H2,1-2H3,(H3,27,28)/t21-/m1/s1 |
| InChIKey | ZVYANTBXTPOFAQ-OAQYLSRUSA-N |
| XLogP | 4.82 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|