About CID 143959293
CID 143959293 (PubChem CID 143959293) has the molecular formula C7H4BClF3O
and a molecular weight of 207.37 g/mol.
Molecular Properties
| Compound Name | CID 143959293 |
| PubChem CID | 143959293 |
| Molecular Formula | C7H4BClF3O |
| Molecular Weight | 207.37 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | — |
| SMILES | O[B]c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C7H4BClF3O/c9-4-1-2-6(8-13)5(3-4)7(10,11)12/h1-3,13H |
| InChIKey | WCDJFKFQHVQLLD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 143959293 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143959293?
The IUPAC name of CID 143959293 (CID 143959293) is not available.
What is the SMILES notation for CID 143959293?
The canonical SMILES for CID 143959293 is O[B]c1ccc(Cl)cc1C(F)(F)F.
What is the InChIKey of CID 143959293?
The InChIKey is WCDJFKFQHVQLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BClF3O/c9-4-1-2-6(8-13)5(3-4)7(10,11)12/h1-3,13H.
What are the key properties of CID 143959293?
CID 143959293 has a molecular weight of 207.37 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143959293 is sourced from PubChem (CID 143959293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).