About 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone
1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone (PubChem CID 143959720) has the molecular formula C7H16N2O3S
and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone |
| PubChem CID | 143959720 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(S(C)(O)O)CC1 |
| InChI | InChI=1S/C7H16N2O3S/c1-7(10)8-3-5-9(6-4-8)13(2,11)12/h11-12H,3-6H2,1-2H3 |
| InChIKey | YCAYXGFYSNATTR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone (CID 143959720) is 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone is CC(=O)N1CCN(S(C)(O)O)CC1.
What is the InChIKey of 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone?
The InChIKey is YCAYXGFYSNATTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3S/c1-7(10)8-3-5-9(6-4-8)13(2,11)12/h11-12H,3-6H2,1-2H3.
What are the key properties of 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone?
1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone has a molecular weight of 208.28 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[dihydroxy(methyl)-λ4-sulfanyl]piperazin-1-yl]ethanone is sourced from PubChem (CID 143959720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).