C21H17F2N3O — CID 143960025
2-(2,10-difluoro-6-methoxy-7H-indolo[2,3-b]carbazol-5-yl)ethanamine (PubChem CID 143960025) has the molecular formula C21H17F2N3O and a molecular weight of 365.38 g/mol. Its IUPAC name is 2-(2,10-difluoro-6-methoxy-7H-indolo[2,3-b]carbazol-5-yl)ethanamine.
| Compound Name | 2-(2,10-difluoro-6-methoxy-7H-indolo[2,3-b]carbazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 143960025 |
| Molecular Formula | C21H17F2N3O |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-(2,10-difluoro-6-methoxy-7H-indolo[2,3-b]carbazol-5-yl)ethanamine |
| SMILES | COc1c2[nH]c3ccc(F)cc3c2cc2c3cc(F)ccc3n(CCN)c12 |
| InChI | InChI=1S/C21H17F2N3O/c1-27-21-19-15(13-8-11(22)2-4-17(13)25-19)10-16-14-9-12(23)3-5-18(14)26(7-6-24)20(16)21/h2-5,8-10,25H,6-7,24H2,1H3 |
| InChIKey | KLGXBDZVIQFIBX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |