C19H26N2 — CID 143961031
N-[(3Z)-2-(4-benzylpiperidin-1-yl)penta-1,3-dien-3-yl]ethanimine (PubChem CID 143961031) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[(3Z)-2-(4-benzylpiperidin-1-yl)penta-1,3-dien-3-yl]ethanimine.
| Compound Name | N-[(3Z)-2-(4-benzylpiperidin-1-yl)penta-1,3-dien-3-yl]ethanimine |
|---|---|
| PubChem CID | 143961031 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[(3Z)-2-(4-benzylpiperidin-1-yl)penta-1,3-dien-3-yl]ethanimine |
| SMILES | C=C(C(=C/C)/N=C/C)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N2/c1-4-19(20-5-2)16(3)21-13-11-18(12-14-21)15-17-9-7-6-8-10-17/h4-10,18H,3,11-15H2,1-2H3/b19-4-,20-5+ |
| InChIKey | CDOIPUIBFMHERR-RULKVFSWSA-N |
| XLogP | 4.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|