C25H22ClN5O4 — CID 143962614
5-[(Z)-2,3-bis(methylideneamino)prop-2-enyl]-2-(2-chlorophenyl)-4-[(3-methoxyphenoxy)methyl]-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 143962614) has the molecular formula C25H22ClN5O4 and a molecular weight of 491.94 g/mol. Its IUPAC name is 5-[(Z)-2,3-bis(methylideneamino)prop-2-enyl]-2-(2-chlorophenyl)-4-[(3-methoxyphenoxy)methyl]-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 5-[(Z)-2,3-bis(methylideneamino)prop-2-enyl]-2-(2-chlorophenyl)-4-[(3-methoxyphenoxy)methyl]-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 143962614 |
| Molecular Formula | C25H22ClN5O4 |
| Molecular Weight | 491.94 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 5-[(Z)-2,3-bis(methylideneamino)prop-2-enyl]-2-(2-chlorophenyl)-4-[(3-methoxyphenoxy)methyl]-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | C=N/C=C(/Cn1c(COc2cccc(OC)c2)c2c(=O)n(-c3ccccc3Cl)[nH]c2cc1=O)N=C |
| InChI | InChI=1S/C25H22ClN5O4/c1-27-13-16(28-2)14-30-22(15-35-18-8-6-7-17(11-18)34-3)24-20(12-23(30)32)29-31(25(24)33)21-10-5-4-9-19(21)26/h4-13,29H,1-2,14-15H2,3H3/b16-13- |
| InChIKey | CAJPPBIXWOSQHK-SSZFMOIBSA-N |
| XLogP | 3.96 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.94 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|