About (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol
(Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol (PubChem CID 143962760) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol.
Molecular Properties
| Compound Name | (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol |
| PubChem CID | 143962760 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol |
| SMILES | C=C(/C(N)=C(\C)O)C(C)(C)C |
| InChI | InChI=1S/C9H17NO/c1-6(9(3,4)5)8(10)7(2)11/h11H,1,10H2,2-5H3/b8-7- |
| InChIKey | MPACKFHWAONHFL-FPLPWBNLSA-N |
| XLogP | 2.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol?
The IUPAC name of (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol (CID 143962760) is (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol.
What is the SMILES notation for (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol?
The canonical SMILES for (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol is C=C(/C(N)=C(\C)O)C(C)(C)C.
What is the InChIKey of (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol?
The InChIKey is MPACKFHWAONHFL-FPLPWBNLSA-N. The full InChI is InChI=1S/C9H17NO/c1-6(9(3,4)5)8(10)7(2)11/h11H,1,10H2,2-5H3/b8-7-.
What are the key properties of (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol?
(Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol has a molecular weight of 155.24 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-5,5-dimethyl-4-methylidenehex-2-en-2-ol is sourced from PubChem (CID 143962760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).