C14H23NO — CID 174282510
(2Z,6E)-3-amino-7,8,9-trimethyl-4-methylidenedeca-2,6,8-trien-2-ol (PubChem CID 174282510) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (2Z,6E)-3-amino-7,8,9-trimethyl-4-methylidenedeca-2,6,8-trien-2-ol.
| Compound Name | (2Z,6E)-3-amino-7,8,9-trimethyl-4-methylidenedeca-2,6,8-trien-2-ol |
|---|---|
| PubChem CID | 174282510 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2Z,6E)-3-amino-7,8,9-trimethyl-4-methylidenedeca-2,6,8-trien-2-ol |
| SMILES | C=C(C/C=C(\C)C(C)=C(C)C)/C(N)=C(\C)O |
| InChI | InChI=1S/C14H23NO/c1-9(2)12(5)10(3)7-8-11(4)14(15)13(6)16/h7,16H,4,8,15H2,1-3,5-6H3/b10-7+,14-13- |
| InChIKey | ZEZZBEMQWAFXOM-NAXUZSFSSA-N |
| XLogP | 3.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|