C13H22O4 — CID 143962984
ethane;methyl 2-[(2Z,4Z)-5-formylhepta-2,4-dien-4-yl]oxyacetate (PubChem CID 143962984) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is ethane;methyl 2-[(2Z,4Z)-5-formylhepta-2,4-dien-4-yl]oxyacetate.
| Compound Name | ethane;methyl 2-[(2Z,4Z)-5-formylhepta-2,4-dien-4-yl]oxyacetate |
|---|---|
| PubChem CID | 143962984 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | ethane;methyl 2-[(2Z,4Z)-5-formylhepta-2,4-dien-4-yl]oxyacetate |
| SMILES | C/C=C\C(OCC(=O)OC)=C(\C=O)CC.CC |
| InChI | InChI=1S/C11H16O4.C2H6/c1-4-6-10(9(5-2)7-12)15-8-11(13)14-3;1-2/h4,6-7H,5,8H2,1-3H3;1-2H3/b6-4-,10-9-; |
| InChIKey | WJAUJSGAHGCBHD-FZCVCVDZSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|