C18H22O4 — CID 155804029
[(2E,4E,5E)-3-ethyl-4-ethylidene-5-formyl-1-oxohepta-2,5-dien-2-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 155804029) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(2E,4E,5E)-3-ethyl-4-ethylidene-5-formyl-1-oxohepta-2,5-dien-2-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(2E,4E,5E)-3-ethyl-4-ethylidene-5-formyl-1-oxohepta-2,5-dien-2-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 155804029 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(2E,4E,5E)-3-ethyl-4-ethylidene-5-formyl-1-oxohepta-2,5-dien-2-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)O/C(C=O)=C(CC)/C(=C\C)C(/C=O)=C\C |
| InChI | InChI=1S/C18H22O4/c1-5-9-10-11-18(21)22-17(13-20)16(8-4)15(7-3)14(6-2)12-19/h5-7,9-13H,8H2,1-4H3/b9-5+,11-10+,14-6-,15-7-,17-16+ |
| InChIKey | KTZSNOSMIQTALG-SRQDYPCJSA-N |
| XLogP | 3.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|