C16H20O4 — CID 91612303
ethyl 6-oxo-5-penta-2,4-dienyl-4-propylpyran-2-carboxylate (PubChem CID 91612303) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is ethyl 6-oxo-5-penta-2,4-dienyl-4-propylpyran-2-carboxylate.
| Compound Name | ethyl 6-oxo-5-penta-2,4-dienyl-4-propylpyran-2-carboxylate |
|---|---|
| PubChem CID | 91612303 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | ethyl 6-oxo-5-penta-2,4-dienyl-4-propylpyran-2-carboxylate |
| SMILES | C=CC=CCc1c(CCC)cc(C(=O)OCC)oc1=O |
| InChI | InChI=1S/C16H20O4/c1-4-7-8-10-13-12(9-5-2)11-14(20-15(13)17)16(18)19-6-3/h4,7-8,11H,1,5-6,9-10H2,2-3H3 |
| InChIKey | LKXVKMXSXOVYLE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|