C16H16O5 — CID 11323678
6-[(2E,4E)-hexa-2,4-dienoyl]-4a,8-dimethyl-1,4-benzodioxine-3,7-dione (PubChem CID 11323678) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-[(2E,4E)-hexa-2,4-dienoyl]-4a,8-dimethyl-1,4-benzodioxine-3,7-dione.
| Compound Name | 6-[(2E,4E)-hexa-2,4-dienoyl]-4a,8-dimethyl-1,4-benzodioxine-3,7-dione |
|---|---|
| PubChem CID | 11323678 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 6-[(2E,4E)-hexa-2,4-dienoyl]-4a,8-dimethyl-1,4-benzodioxine-3,7-dione |
| SMILES | C/C=C/C=C/C(=O)C1=CC2(C)OC(=O)COC2=C(C)C1=O |
| InChI | InChI=1S/C16H16O5/c1-4-5-6-7-12(17)11-8-16(3)15(10(2)14(11)19)20-9-13(18)21-16/h4-8H,9H2,1-3H3/b5-4+,7-6+ |
| InChIKey | GWPLIJLXDISJQS-YTXTXJHMSA-N |
| XLogP | 1.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|