C19H24O7 — CID 172537017
2-[2-[(2-oxo-8,8a-dihydrochromen-6-yl)oxy]acetyl]oxyethyl 2,2-dimethylbutanoate (PubChem CID 172537017) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-[2-[(2-oxo-8,8a-dihydrochromen-6-yl)oxy]acetyl]oxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[2-[(2-oxo-8,8a-dihydrochromen-6-yl)oxy]acetyl]oxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 172537017 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[2-[(2-oxo-8,8a-dihydrochromen-6-yl)oxy]acetyl]oxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)COC1=CCC2OC(=O)C=CC2=C1 |
| InChI | InChI=1S/C19H24O7/c1-4-19(2,3)18(22)24-10-9-23-17(21)12-25-14-6-7-15-13(11-14)5-8-16(20)26-15/h5-6,8,11,15H,4,7,9-10,12H2,1-3H3 |
| InChIKey | RSVFLHOKMNCYPR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|