C17H22O5 — CID 54427613
2-[(2-oxo-4a,8a-dihydrochromen-7-yl)oxy]ethyl 2,2-dimethylbutanoate (PubChem CID 54427613) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[(2-oxo-4a,8a-dihydrochromen-7-yl)oxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[(2-oxo-4a,8a-dihydrochromen-7-yl)oxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 54427613 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[(2-oxo-4a,8a-dihydrochromen-7-yl)oxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC1=CC2OC(=O)C=CC2C=C1 |
| InChI | InChI=1S/C17H22O5/c1-4-17(2,3)16(19)21-10-9-20-13-7-5-12-6-8-15(18)22-14(12)11-13/h5-8,11-12,14H,4,9-10H2,1-3H3 |
| InChIKey | WFFURIDBWXPBDD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|