About ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate
ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate (PubChem CID 54120697) has the molecular formula C16H16O5
and a molecular weight of 288.30 g/mol. Its IUPAC name is ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate |
| PubChem CID | 54120697 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2c(o1)=C1C=CCOC1C(C)C=2 |
| InChI | InChI=1S/C16H16O5/c1-3-19-16(18)13-8-12(17)11-7-9(2)14-10(15(11)21-13)5-4-6-20-14/h4-5,7-9,14H,3,6H2,1-2H3 |
| InChIKey | NNMHRURPTHORSM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate?
The IUPAC name of ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate (CID 54120697) is ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate.
What is the SMILES notation for ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate?
The canonical SMILES for ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate is CCOC(=O)c1cc(=O)c2c(o1)=C1C=CCOC1C(C)C=2.
What is the InChIKey of ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate?
The InChIKey is NNMHRURPTHORSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O5/c1-3-19-16(18)13-8-12(17)11-7-9(2)14-10(15(11)21-13)5-4-6-20-14/h4-5,7-9,14H,3,6H2,1-2H3.
What are the key properties of ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate?
ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate has a molecular weight of 288.30 g/mol, XLogP of 0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-methyl-4-oxo-6a,8-dihydro-6H-pyrano[2,3-h]chromene-2-carboxylate is sourced from PubChem (CID 54120697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).