C16H26O4 — CID 90927086
methyl 2,5-dimethoxy-6,8-dimethylundeca-2,7,9-trienoate (PubChem CID 90927086) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl 2,5-dimethoxy-6,8-dimethylundeca-2,7,9-trienoate.
| Compound Name | methyl 2,5-dimethoxy-6,8-dimethylundeca-2,7,9-trienoate |
|---|---|
| PubChem CID | 90927086 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl 2,5-dimethoxy-6,8-dimethylundeca-2,7,9-trienoate |
| SMILES | CC=CC(C)=CC(C)C(CC=C(OC)C(=O)OC)OC |
| InChI | InChI=1S/C16H26O4/c1-7-8-12(2)11-13(3)14(18-4)9-10-15(19-5)16(17)20-6/h7-8,10-11,13-14H,9H2,1-6H3 |
| InChIKey | OLGROYHMQFJBLF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|