C18H28O5 — CID 5371681
methyl (2E,6E,10E)-12-acetyloxy-2-methoxy-6,10-dimethyldodeca-2,6,10-trienoate (PubChem CID 5371681) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl (2E,6E,10E)-12-acetyloxy-2-methoxy-6,10-dimethyldodeca-2,6,10-trienoate.
| Compound Name | methyl (2E,6E,10E)-12-acetyloxy-2-methoxy-6,10-dimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 5371681 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | methyl (2E,6E,10E)-12-acetyloxy-2-methoxy-6,10-dimethyldodeca-2,6,10-trienoate |
| SMILES | COC(=O)/C(=C\CC/C(C)=C/CC/C(C)=C/COC(C)=O)OC |
| InChI | InChI=1S/C18H28O5/c1-14(10-7-11-17(21-4)18(20)22-5)8-6-9-15(2)12-13-23-16(3)19/h8,11-12H,6-7,9-10,13H2,1-5H3/b14-8+,15-12+,17-11+ |
| InChIKey | CYKANRURPIJLEQ-ACECNAPFSA-N |
| XLogP | 3.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|