C18H24O4 — CID 134971668
[(3E)-4-methyl-1-(2-methyl-5-oxofuran-2-yl)hexa-3,5-dienyl] (E)-4-methylpent-2-enoate (PubChem CID 134971668) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is [(3E)-4-methyl-1-(2-methyl-5-oxofuran-2-yl)hexa-3,5-dienyl] (E)-4-methylpent-2-enoate.
| Compound Name | [(3E)-4-methyl-1-(2-methyl-5-oxofuran-2-yl)hexa-3,5-dienyl] (E)-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 134971668 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [(3E)-4-methyl-1-(2-methyl-5-oxofuran-2-yl)hexa-3,5-dienyl] (E)-4-methylpent-2-enoate |
| SMILES | C=C/C(C)=C/CC(OC(=O)/C=C/C(C)C)C1(C)C=CC(=O)O1 |
| InChI | InChI=1S/C18H24O4/c1-6-14(4)8-9-15(18(5)12-11-17(20)22-18)21-16(19)10-7-13(2)3/h6-8,10-13,15H,1,9H2,2-5H3/b10-7+,14-8+ |
| InChIKey | BPGUEXLSWRQCFK-XFUBVATKSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|