C22H32O3 — CID 139589863
(2R,3S)-3-hydroxy-3-methyl-2-[(1E,3E,5R,7E,9E,11S)-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-2H-pyran-6-one (PubChem CID 139589863) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-3-methyl-2-[(1E,3E,5R,7E,9E,11S)-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-2H-pyran-6-one.
| Compound Name | (2R,3S)-3-hydroxy-3-methyl-2-[(1E,3E,5R,7E,9E,11S)-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-2H-pyran-6-one |
|---|---|
| PubChem CID | 139589863 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2R,3S)-3-hydroxy-3-methyl-2-[(1E,3E,5R,7E,9E,11S)-5,7,11-trimethyltrideca-1,3,7,9-tetraenyl]-2H-pyran-6-one |
| SMILES | CC[C@H](C)/C=C/C=C(\C)C[C@@H](C)/C=C/C=C/[C@H]1OC(=O)C=C[C@]1(C)O |
| InChI | InChI=1S/C22H32O3/c1-6-17(2)11-9-12-19(4)16-18(3)10-7-8-13-20-22(5,24)15-14-21(23)25-20/h7-15,17-18,20,24H,6,16H2,1-5H3/b10-7+,11-9+,13-8+,19-12+/t17-,18-,20+,22-/m0/s1 |
| InChIKey | TZKWUDHMMMXQDI-UIUNBINMSA-N |
| XLogP | 4.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|